C13H16N6O5 — CID 19342185
methyl 1-methyl-4-[3-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]pyrazole-5-carboxylate (PubChem CID 19342185) has the molecular formula C13H16N6O5 and a molecular weight of 336.31 g/mol. Its IUPAC name is methyl 1-methyl-4-[3-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]pyrazole-5-carboxylate.
| Compound Name | methyl 1-methyl-4-[3-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 19342185 |
| Molecular Formula | C13H16N6O5 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | methyl 1-methyl-4-[3-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]pyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCn2nc([N+](=O)[O-])cc2C)cnn1C |
| InChI | InChI=1S/C13H16N6O5/c1-8-6-10(19(22)23)16-18(8)5-4-11(20)15-9-7-14-17(2)12(9)13(21)24-3/h6-7H,4-5H2,1-3H3,(H,15,20) |
| InChIKey | CENURKWVVMVUIV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|