C15H17N5O6 — CID 19541775
N-(4-ethoxy-2-nitrophenyl)-3-(5-methyl-3-nitropyrazol-1-yl)propanamide (PubChem CID 19541775) has the molecular formula C15H17N5O6 and a molecular weight of 363.33 g/mol. Its IUPAC name is N-(4-ethoxy-2-nitrophenyl)-3-(5-methyl-3-nitropyrazol-1-yl)propanamide.
| Compound Name | N-(4-ethoxy-2-nitrophenyl)-3-(5-methyl-3-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19541775 |
| Molecular Formula | C15H17N5O6 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-(4-ethoxy-2-nitrophenyl)-3-(5-methyl-3-nitropyrazol-1-yl)propanamide |
| SMILES | CCOc1ccc(NC(=O)CCn2nc([N+](=O)[O-])cc2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17N5O6/c1-3-26-11-4-5-12(13(9-11)19(22)23)16-15(21)6-7-18-10(2)8-14(17-18)20(24)25/h4-5,8-9H,3,6-7H2,1-2H3,(H,16,21) |
| InChIKey | UFNCSCZKMHZFSB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|