C14H25N5O3 — CID 19553643
N-[2-(diethylamino)ethyl]-2-(5-methyl-3-nitropyrazol-1-yl)butanamide (PubChem CID 19553643) has the molecular formula C14H25N5O3 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-(5-methyl-3-nitropyrazol-1-yl)butanamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-(5-methyl-3-nitropyrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 19553643 |
| Molecular Formula | C14H25N5O3 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-(5-methyl-3-nitropyrazol-1-yl)butanamide |
| SMILES | CCC(C(=O)NCCN(CC)CC)n1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C14H25N5O3/c1-5-12(14(20)15-8-9-17(6-2)7-3)18-11(4)10-13(16-18)19(21)22/h10,12H,5-9H2,1-4H3,(H,15,20) |
| InChIKey | UGDDABJIGICJGH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|