C17H20F2N4O4 — CID 19562258
N-[2-(difluoromethoxy)-5-methylphenyl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanamide (PubChem CID 19562258) has the molecular formula C17H20F2N4O4 and a molecular weight of 382.37 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-5-methylphenyl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanamide.
| Compound Name | N-[2-(difluoromethoxy)-5-methylphenyl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 19562258 |
| Molecular Formula | C17H20F2N4O4 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[2-(difluoromethoxy)-5-methylphenyl]-3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-methylpropanamide |
| SMILES | Cc1ccc(OC(F)F)c(NC(=O)C(C)Cn2nc(C)c([N+](=O)[O-])c2C)c1 |
| InChI | InChI=1S/C17H20F2N4O4/c1-9-5-6-14(27-17(18)19)13(7-9)20-16(24)10(2)8-22-12(4)15(23(25)26)11(3)21-22/h5-7,10,17H,8H2,1-4H3,(H,20,24) |
| InChIKey | PSERXRNKCSHSEF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|