C12H21N5O4 — CID 63944877
2-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-hydroxypropyl]amino]-N-methylpropanamide (PubChem CID 63944877) has the molecular formula C12H21N5O4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-hydroxypropyl]amino]-N-methylpropanamide.
| Compound Name | 2-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-hydroxypropyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 63944877 |
| Molecular Formula | C12H21N5O4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-[[3-(3,5-dimethyl-4-nitropyrazol-1-yl)-2-hydroxypropyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NCC(O)Cn1nc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C12H21N5O4/c1-7-11(17(20)21)9(3)16(15-7)6-10(18)5-14-8(2)12(19)13-4/h8,10,14,18H,5-6H2,1-4H3,(H,13,19) |
| InChIKey | FKXPBYRHNGBCJG-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|