C11H14F2N4O3 — CID 175397290
5-(4,4-difluorocyclohexyl)-3-methyl-4-nitropyrazole-1-carboxamide (PubChem CID 175397290) has the molecular formula C11H14F2N4O3 and a molecular weight of 288.25 g/mol. Its IUPAC name is 5-(4,4-difluorocyclohexyl)-3-methyl-4-nitropyrazole-1-carboxamide.
| Compound Name | 5-(4,4-difluorocyclohexyl)-3-methyl-4-nitropyrazole-1-carboxamide |
|---|---|
| PubChem CID | 175397290 |
| Molecular Formula | C11H14F2N4O3 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 5-(4,4-difluorocyclohexyl)-3-methyl-4-nitropyrazole-1-carboxamide |
| SMILES | Cc1nn(C(N)=O)c(C2CCC(F)(F)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14F2N4O3/c1-6-8(17(19)20)9(16(15-6)10(14)18)7-2-4-11(12,13)5-3-7/h7H,2-5H2,1H3,(H2,14,18) |
| InChIKey | KPYFEFLGKHNREE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|