C10H14F2N4O — CID 175584216
5-(4,4-difluorocyclohexyl)-2-methyltriazole-4-carboxamide (PubChem CID 175584216) has the molecular formula C10H14F2N4O and a molecular weight of 244.24 g/mol. Its IUPAC name is 5-(4,4-difluorocyclohexyl)-2-methyltriazole-4-carboxamide.
| Compound Name | 5-(4,4-difluorocyclohexyl)-2-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 175584216 |
| Molecular Formula | C10H14F2N4O |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 5-(4,4-difluorocyclohexyl)-2-methyltriazole-4-carboxamide |
| SMILES | Cn1nc(C(N)=O)c(C2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C10H14F2N4O/c1-16-14-7(8(15-16)9(13)17)6-2-4-10(11,12)5-3-6/h6H,2-5H2,1H3,(H2,13,17) |
| InChIKey | FDVOLRGPIJUGAS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |