C9H14F2N4 — CID 104605344
5-(4,4-difluorocyclohexyl)-2-methyl-1,2,4-triazol-3-amine (PubChem CID 104605344) has the molecular formula C9H14F2N4 and a molecular weight of 216.23 g/mol. Its IUPAC name is 5-(4,4-difluorocyclohexyl)-2-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(4,4-difluorocyclohexyl)-2-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 104605344 |
| Molecular Formula | C9H14F2N4 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 5-(4,4-difluorocyclohexyl)-2-methyl-1,2,4-triazol-3-amine |
| SMILES | Cn1nc(C2CCC(F)(F)CC2)nc1N |
| InChI | InChI=1S/C9H14F2N4/c1-15-8(12)13-7(14-15)6-2-4-9(10,11)5-3-6/h6H,2-5H2,1H3,(H2,12,13,14) |
| InChIKey | MAVQZMQLCKSUFQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |