C8H14N4O — CID 114824901
2-methyl-5-(5-methyloxolan-3-yl)-1,2,4-triazol-3-amine (PubChem CID 114824901) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-methyl-5-(5-methyloxolan-3-yl)-1,2,4-triazol-3-amine.
| Compound Name | 2-methyl-5-(5-methyloxolan-3-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 114824901 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-methyl-5-(5-methyloxolan-3-yl)-1,2,4-triazol-3-amine |
| SMILES | CC1CC(c2nc(N)n(C)n2)CO1 |
| InChI | InChI=1S/C8H14N4O/c1-5-3-6(4-13-5)7-10-8(9)12(2)11-7/h5-6H,3-4H2,1-2H3,(H2,9,10,11) |
| InChIKey | AGWSVBAIXUUZMM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |