C7H12N4OS — CID 114825995
4-amino-3-(5-methyloxolan-3-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 114825995) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is 4-amino-3-(5-methyloxolan-3-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-(5-methyloxolan-3-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 114825995 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 4-amino-3-(5-methyloxolan-3-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CC1CC(c2n[nH]c(=S)n2N)CO1 |
| InChI | InChI=1S/C7H12N4OS/c1-4-2-5(3-12-4)6-9-10-7(13)11(6)8/h4-5H,2-3,8H2,1H3,(H,10,13) |
| InChIKey | WCUTTWVYGHYIAT-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|