C7H12N4S — CID 15519784
4-amino-3-cyclopentyl-1H-1,2,4-triazole-5-thione (PubChem CID 15519784) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is 4-amino-3-cyclopentyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-cyclopentyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 15519784 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 4-amino-3-cyclopentyl-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(C2CCCC2)n[nH]c1=S |
| InChI | InChI=1S/C7H12N4S/c8-11-6(9-10-7(11)12)5-3-1-2-4-5/h5H,1-4,8H2,(H,10,12) |
| InChIKey | DZBDCWKJNGVXIO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|