C9H13F3N4S — CID 113433984
4-amino-3-[2-(trifluoromethyl)cyclohexyl]-1H-1,2,4-triazole-5-thione (PubChem CID 113433984) has the molecular formula C9H13F3N4S and a molecular weight of 266.29 g/mol. Its IUPAC name is 4-amino-3-[2-(trifluoromethyl)cyclohexyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-[2-(trifluoromethyl)cyclohexyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 113433984 |
| Molecular Formula | C9H13F3N4S |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 4-amino-3-[2-(trifluoromethyl)cyclohexyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(C2CCCCC2C(F)(F)F)n[nH]c1=S |
| InChI | InChI=1S/C9H13F3N4S/c10-9(11,12)6-4-2-1-3-5(6)7-14-15-8(17)16(7)13/h5-6H,1-4,13H2,(H,15,17) |
| InChIKey | XHZDTDAGIXXIQI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|