C9H15N3O — CID 114826023
5-ethyl-3-(5-methyloxolan-3-yl)-1H-1,2,4-triazole (PubChem CID 114826023) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-ethyl-3-(5-methyloxolan-3-yl)-1H-1,2,4-triazole.
| Compound Name | 5-ethyl-3-(5-methyloxolan-3-yl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 114826023 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 5-ethyl-3-(5-methyloxolan-3-yl)-1H-1,2,4-triazole |
| SMILES | CCc1nc(C2COC(C)C2)n[nH]1 |
| InChI | InChI=1S/C9H15N3O/c1-3-8-10-9(12-11-8)7-4-6(2)13-5-7/h6-7H,3-5H2,1-2H3,(H,10,11,12) |
| InChIKey | BLEKDYPLBXIEMI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |