C8H16Cl2N4O — CID 167739757
2-(5-ethyl-1H-1,2,4-triazol-3-yl)morpholine;dihydrochloride (PubChem CID 167739757) has the molecular formula C8H16Cl2N4O and a molecular weight of 255.15 g/mol. Its IUPAC name is 2-(5-ethyl-1H-1,2,4-triazol-3-yl)morpholine;dihydrochloride.
| Compound Name | 2-(5-ethyl-1H-1,2,4-triazol-3-yl)morpholine;dihydrochloride |
|---|---|
| PubChem CID | 167739757 |
| Molecular Formula | C8H16Cl2N4O |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-(5-ethyl-1H-1,2,4-triazol-3-yl)morpholine;dihydrochloride |
| SMILES | CCc1nc(C2CNCCO2)n[nH]1.Cl.Cl |
| InChI | InChI=1S/C8H14N4O.2ClH/c1-2-7-10-8(12-11-7)6-5-9-3-4-13-6;;/h6,9H,2-5H2,1H3,(H,10,11,12);2*1H |
| InChIKey | BUAHWYLEPCXLRP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |