C12H20N4O — CID 115041635
4-[[3-(oxolan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]piperidine (PubChem CID 115041635) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 4-[[3-(oxolan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]piperidine.
| Compound Name | 4-[[3-(oxolan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]piperidine |
|---|---|
| PubChem CID | 115041635 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 4-[[3-(oxolan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]piperidine |
| SMILES | C1COC(c2n[nH]c(CC3CCNCC3)n2)C1 |
| InChI | InChI=1S/C12H20N4O/c1-2-10(17-7-1)12-14-11(15-16-12)8-9-3-5-13-6-4-9/h9-10,13H,1-8H2,(H,14,15,16) |
| InChIKey | SRBSBFUSMMMXHN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |