C8H15N5 — CID 104915236
2-methyl-5-[(2S)-piperidin-2-yl]-1,2,4-triazol-3-amine (PubChem CID 104915236) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-methyl-5-[(2S)-piperidin-2-yl]-1,2,4-triazol-3-amine.
| Compound Name | 2-methyl-5-[(2S)-piperidin-2-yl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 104915236 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 2-methyl-5-[(2S)-piperidin-2-yl]-1,2,4-triazol-3-amine |
| SMILES | Cn1nc([C@@H]2CCCCN2)nc1N |
| InChI | InChI=1S/C8H15N5/c1-13-8(9)11-7(12-13)6-4-2-3-5-10-6/h6,10H,2-5H2,1H3,(H2,9,11,12)/t6-/m0/s1 |
| InChIKey | UBPAGQLLTAULRE-LURJTMIESA-N |
| XLogP | 0.21 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |