C10H18N4 — CID 64562693
2-(2,5-dimethyl-1,2,4-triazol-3-yl)azepane (PubChem CID 64562693) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1,2,4-triazol-3-yl)azepane.
| Compound Name | 2-(2,5-dimethyl-1,2,4-triazol-3-yl)azepane |
|---|---|
| PubChem CID | 64562693 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 2-(2,5-dimethyl-1,2,4-triazol-3-yl)azepane |
| SMILES | Cc1nc(C2CCCCCN2)n(C)n1 |
| InChI | InChI=1S/C10H18N4/c1-8-12-10(14(2)13-8)9-6-4-3-5-7-11-9/h9,11H,3-7H2,1-2H3 |
| InChIKey | XTFYEKDALCHVPN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |