C9H16N4 — CID 64562303
2-(4-methyl-1,2,4-triazol-3-yl)azepane (PubChem CID 64562303) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(4-methyl-1,2,4-triazol-3-yl)azepane.
| Compound Name | 2-(4-methyl-1,2,4-triazol-3-yl)azepane |
|---|---|
| PubChem CID | 64562303 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 2-(4-methyl-1,2,4-triazol-3-yl)azepane |
| SMILES | Cn1cnnc1C1CCCCCN1 |
| InChI | InChI=1S/C9H16N4/c1-13-7-11-12-9(13)8-5-3-2-4-6-10-8/h7-8,10H,2-6H2,1H3 |
| InChIKey | CPINTJOCGHZIRE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |