C13H16N4 — CID 82473887
4-(2-methylphenyl)-3-pyrrolidin-2-yl-1,2,4-triazole (PubChem CID 82473887) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 4-(2-methylphenyl)-3-pyrrolidin-2-yl-1,2,4-triazole.
| Compound Name | 4-(2-methylphenyl)-3-pyrrolidin-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 82473887 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-(2-methylphenyl)-3-pyrrolidin-2-yl-1,2,4-triazole |
| SMILES | Cc1ccccc1-n1cnnc1C1CCCN1 |
| InChI | InChI=1S/C13H16N4/c1-10-5-2-3-7-12(10)17-9-15-16-13(17)11-6-4-8-14-11/h2-3,5,7,9,11,14H,4,6,8H2,1H3 |
| InChIKey | NGTZTGTXFZGLNP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |