C12H13ClN4 — CID 82480433
4-(4-chlorophenyl)-3-pyrrolidin-2-yl-1,2,4-triazole (PubChem CID 82480433) has the molecular formula C12H13ClN4 and a molecular weight of 248.72 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-pyrrolidin-2-yl-1,2,4-triazole.
| Compound Name | 4-(4-chlorophenyl)-3-pyrrolidin-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 82480433 |
| Molecular Formula | C12H13ClN4 |
| Molecular Weight | 248.72 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-(4-chlorophenyl)-3-pyrrolidin-2-yl-1,2,4-triazole |
| SMILES | Clc1ccc(-n2cnnc2C2CCCN2)cc1 |
| InChI | InChI=1S/C12H13ClN4/c13-9-3-5-10(6-4-9)17-8-15-16-12(17)11-2-1-7-14-11/h3-6,8,11,14H,1-2,7H2 |
| InChIKey | KXBOJHOXWXZBHF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.72 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |