C10H16N4 — CID 104915223
(2R)-2-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidine (PubChem CID 104915223) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is (2R)-2-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidine.
| Compound Name | (2R)-2-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidine |
|---|---|
| PubChem CID | 104915223 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (2R)-2-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidine |
| SMILES | c1nnc([C@H]2CCCCN2)n1C1CC1 |
| InChI | InChI=1S/C10H16N4/c1-2-6-11-9(3-1)10-13-12-7-14(10)8-4-5-8/h7-9,11H,1-6H2/t9-/m1/s1 |
| InChIKey | VOANHVLCNYRUKV-SECBINFHSA-N |
| XLogP | 1.43 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |