C10H18N4 — CID 94552646
(2R)-2-(4-propyl-1,2,4-triazol-3-yl)piperidine (PubChem CID 94552646) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is (2R)-2-(4-propyl-1,2,4-triazol-3-yl)piperidine.
| Compound Name | (2R)-2-(4-propyl-1,2,4-triazol-3-yl)piperidine |
|---|---|
| PubChem CID | 94552646 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (2R)-2-(4-propyl-1,2,4-triazol-3-yl)piperidine |
| SMILES | CCCn1cnnc1[C@H]1CCCCN1 |
| InChI | InChI=1S/C10H18N4/c1-2-7-14-8-12-13-10(14)9-5-3-4-6-11-9/h8-9,11H,2-7H2,1H3/t9-/m1/s1 |
| InChIKey | UYIMHMCWIFHTAL-SECBINFHSA-N |
| XLogP | 1.50 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |