C9H16N4S — CID 82909389
3-(4-propyl-1,2,4-triazol-3-yl)thiomorpholine (PubChem CID 82909389) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 3-(4-propyl-1,2,4-triazol-3-yl)thiomorpholine.
| Compound Name | 3-(4-propyl-1,2,4-triazol-3-yl)thiomorpholine |
|---|---|
| PubChem CID | 82909389 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-(4-propyl-1,2,4-triazol-3-yl)thiomorpholine |
| SMILES | CCCn1cnnc1C1CSCCN1 |
| InChI | InChI=1S/C9H16N4S/c1-2-4-13-7-11-12-9(13)8-6-14-5-3-10-8/h7-8,10H,2-6H2,1H3 |
| InChIKey | HCTMWHKHLUKIJO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |