C11H20N4S — CID 50971482
N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]thian-4-amine (PubChem CID 50971482) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]thian-4-amine.
| Compound Name | N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]thian-4-amine |
|---|---|
| PubChem CID | 50971482 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-[1-(2-ethyl-1,2,4-triazol-3-yl)ethyl]thian-4-amine |
| SMILES | CCn1ncnc1C(C)NC1CCSCC1 |
| InChI | InChI=1S/C11H20N4S/c1-3-15-11(12-8-13-15)9(2)14-10-4-6-16-7-5-10/h8-10,14H,3-7H2,1-2H3 |
| InChIKey | YTYZJSNIADOVQR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |