C11H14N4O — CID 82472110
4-(furan-2-ylmethyl)-3-pyrrolidin-2-yl-1,2,4-triazole (PubChem CID 82472110) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-(furan-2-ylmethyl)-3-pyrrolidin-2-yl-1,2,4-triazole.
| Compound Name | 4-(furan-2-ylmethyl)-3-pyrrolidin-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 82472110 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-(furan-2-ylmethyl)-3-pyrrolidin-2-yl-1,2,4-triazole |
| SMILES | c1coc(Cn2cnnc2C2CCCN2)c1 |
| InChI | InChI=1S/C11H14N4O/c1-4-10(12-5-1)11-14-13-8-15(11)7-9-3-2-6-16-9/h2-3,6,8,10,12H,1,4-5,7H2 |
| InChIKey | PUJPSXFNVSYVPL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |