C12H20N4 — CID 62722373
3-cyclopentyl-1-methyl-5-pyrrolidin-2-yl-1,2,4-triazole (PubChem CID 62722373) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-cyclopentyl-1-methyl-5-pyrrolidin-2-yl-1,2,4-triazole.
| Compound Name | 3-cyclopentyl-1-methyl-5-pyrrolidin-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 62722373 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 3-cyclopentyl-1-methyl-5-pyrrolidin-2-yl-1,2,4-triazole |
| SMILES | Cn1nc(C2CCCC2)nc1C1CCCN1 |
| InChI | InChI=1S/C12H20N4/c1-16-12(10-7-4-8-13-10)14-11(15-16)9-5-2-3-6-9/h9-10,13H,2-8H2,1H3 |
| InChIKey | VUTABKQBNJOIQR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |