C13H21BF2N2O2 — CID 169249404
[1-tert-butyl-3-(4,4-difluorocyclohexyl)pyrazol-4-yl]boronic acid (PubChem CID 169249404) has the molecular formula C13H21BF2N2O2 and a molecular weight of 286.13 g/mol. Its IUPAC name is [1-tert-butyl-3-(4,4-difluorocyclohexyl)pyrazol-4-yl]boronic acid.
| Compound Name | [1-tert-butyl-3-(4,4-difluorocyclohexyl)pyrazol-4-yl]boronic acid |
|---|---|
| PubChem CID | 169249404 |
| Molecular Formula | C13H21BF2N2O2 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | [1-tert-butyl-3-(4,4-difluorocyclohexyl)pyrazol-4-yl]boronic acid |
| SMILES | CC(C)(C)n1cc(B(O)O)c(C2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C13H21BF2N2O2/c1-12(2,3)18-8-10(14(19)20)11(17-18)9-4-6-13(15,16)7-5-9/h8-9,19-20H,4-7H2,1-3H3 |
| InChIKey | PLWOBJXBOBTGRC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|