C11H15F2N3 — CID 140912981
2-(4,4-difluorocyclohexyl)pyridine-3,4-diamine (PubChem CID 140912981) has the molecular formula C11H15F2N3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)pyridine-3,4-diamine.
| Compound Name | 2-(4,4-difluorocyclohexyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 140912981 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)pyridine-3,4-diamine |
| SMILES | Nc1ccnc(C2CCC(F)(F)CC2)c1N |
| InChI | InChI=1S/C11H15F2N3/c12-11(13)4-1-7(2-5-11)10-9(15)8(14)3-6-16-10/h3,6-7H,1-2,4-5,15H2,(H2,14,16) |
| InChIKey | SXLWTVODHAHTEL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |