C11H13F2N3O — CID 114226135
N-(3-amino-2-pyridinyl)-3,3-difluorocyclopentane-1-carboxamide (PubChem CID 114226135) has the molecular formula C11H13F2N3O and a molecular weight of 241.24 g/mol. Its IUPAC name is N-(3-amino-2-pyridinyl)-3,3-difluorocyclopentane-1-carboxamide.
| Compound Name | N-(3-amino-2-pyridinyl)-3,3-difluorocyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 114226135 |
| Molecular Formula | C11H13F2N3O |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-(3-amino-2-pyridinyl)-3,3-difluorocyclopentane-1-carboxamide |
| SMILES | Nc1cccnc1NC(=O)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C11H13F2N3O/c12-11(13)4-3-7(6-11)10(17)16-9-8(14)2-1-5-15-9/h1-2,5,7H,3-4,6,14H2,(H,15,16,17) |
| InChIKey | BCZNOGBNJZNIEX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |