C13H15F2N3O2 — CID 177192399
4-[(3,3-difluorocyclohexanecarbonyl)amino]pyridine-2-carboxamide (PubChem CID 177192399) has the molecular formula C13H15F2N3O2 and a molecular weight of 283.28 g/mol. Its IUPAC name is 4-[(3,3-difluorocyclohexanecarbonyl)amino]pyridine-2-carboxamide.
| Compound Name | 4-[(3,3-difluorocyclohexanecarbonyl)amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 177192399 |
| Molecular Formula | C13H15F2N3O2 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-[(3,3-difluorocyclohexanecarbonyl)amino]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(NC(=O)C2CCCC(F)(F)C2)ccn1 |
| InChI | InChI=1S/C13H15F2N3O2/c14-13(15)4-1-2-8(7-13)12(20)18-9-3-5-17-10(6-9)11(16)19/h3,5-6,8H,1-2,4,7H2,(H2,16,19)(H,17,18,20) |
| InChIKey | KGSMNFLUNRKJDT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |