C18H19Cl2F2N3OS — CID 177192771
(1S)-N-(2-aminosulfanyl-4-pyridinyl)-3,3-difluorocyclohexane-1-carboxamide;1,2-dichlorobenzene (PubChem CID 177192771) has the molecular formula C18H19Cl2F2N3OS and a molecular weight of 434.34 g/mol. Its IUPAC name is (1S)-N-(2-aminosulfanyl-4-pyridinyl)-3,3-difluorocyclohexane-1-carboxamide;1,2-dichlorobenzene.
| Compound Name | (1S)-N-(2-aminosulfanyl-4-pyridinyl)-3,3-difluorocyclohexane-1-carboxamide;1,2-dichlorobenzene |
|---|---|
| PubChem CID | 177192771 |
| Molecular Formula | C18H19Cl2F2N3OS |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | (1S)-N-(2-aminosulfanyl-4-pyridinyl)-3,3-difluorocyclohexane-1-carboxamide;1,2-dichlorobenzene |
| SMILES | Clc1ccccc1Cl.NSc1cc(NC(=O)[C@H]2CCCC(F)(F)C2)ccn1 |
| InChI | InChI=1S/C12H15F2N3OS.C6H4Cl2/c13-12(14)4-1-2-8(7-12)11(18)17-9-3-5-16-10(6-9)19-15;7-5-3-1-2-4-6(5)8/h3,5-6,8H,1-2,4,7,15H2,(H,16,17,18);1-4H/t8-;/m0./s1 |
| InChIKey | PQYLINXDJFVMMM-QRPNPIFTSA-N |
| XLogP | 5.80 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|