C19H25F4N3OS — CID 178021144
cis-(1R,2S)-N-(2-aminosulfanyl-4-pyridinyl)-2-(4,4-difluoro-3-methylcyclohexyl)-5,5-difluorocyclohexane-1-carboxamide (PubChem CID 178021144) has the molecular formula C19H25F4N3OS and a molecular weight of 419.49 g/mol. Its IUPAC name is cis-(1R,2S)-N-(2-aminosulfanyl-4-pyridinyl)-2-(4,4-difluoro-3-methylcyclohexyl)-5,5-difluorocyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-(2-aminosulfanyl-4-pyridinyl)-2-(4,4-difluoro-3-methylcyclohexyl)-5,5-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 178021144 |
| Molecular Formula | C19H25F4N3OS |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | cis-(1R,2S)-N-(2-aminosulfanyl-4-pyridinyl)-2-(4,4-difluoro-3-methylcyclohexyl)-5,5-difluorocyclohexane-1-carboxamide |
| SMILES | CC1CC([C@@H]2CCC(F)(F)C[C@H]2C(=O)Nc2ccnc(SN)c2)CCC1(F)F |
| InChI | InChI=1S/C19H25F4N3OS/c1-11-8-12(2-6-19(11,22)23)14-3-5-18(20,21)10-15(14)17(27)26-13-4-7-25-16(9-13)28-24/h4,7,9,11-12,14-15H,2-3,5-6,8,10,24H2,1H3,(H,25,26,27)/t11?,12?,14-,15+/m0/s1 |
| InChIKey | FEQOEXBEYIMLOB-CXTZMWEQSA-N |
| XLogP | 5.11 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|