C19H27F2N3OS — CID 178021291
(1R)-N-(2-aminosulfanyl-4-pyridinyl)-5,5-difluoro-2-[(1R,3R)-3-methylcyclohexyl]cyclohexane-1-carboxamide (PubChem CID 178021291) has the molecular formula C19H27F2N3OS and a molecular weight of 383.51 g/mol. Its IUPAC name is (1R)-N-(2-aminosulfanyl-4-pyridinyl)-5,5-difluoro-2-[(1R,3R)-3-methylcyclohexyl]cyclohexane-1-carboxamide.
| Compound Name | (1R)-N-(2-aminosulfanyl-4-pyridinyl)-5,5-difluoro-2-[(1R,3R)-3-methylcyclohexyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 178021291 |
| Molecular Formula | C19H27F2N3OS |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (1R)-N-(2-aminosulfanyl-4-pyridinyl)-5,5-difluoro-2-[(1R,3R)-3-methylcyclohexyl]cyclohexane-1-carboxamide |
| SMILES | C[C@@H]1CCC[C@@H](C2CCC(F)(F)C[C@H]2C(=O)Nc2ccnc(SN)c2)C1 |
| InChI | InChI=1S/C19H27F2N3OS/c1-12-3-2-4-13(9-12)15-5-7-19(20,21)11-16(15)18(25)24-14-6-8-23-17(10-14)26-22/h6,8,10,12-13,15-16H,2-5,7,9,11,22H2,1H3,(H,23,24,25)/t12-,13-,15?,16-/m1/s1 |
| InChIKey | BMIKTCRWBACISK-IKCLOSNESA-N |
| XLogP | 4.86 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|