C18H23F2N3OS — CID 178021397
trans-(1R,2R)-N-(2-aminosulfanyl-4-pyridinyl)-2-(cyclohexen-1-yl)-5,5-difluorocyclohexane-1-carboxamide (PubChem CID 178021397) has the molecular formula C18H23F2N3OS and a molecular weight of 367.47 g/mol. Its IUPAC name is trans-(1R,2R)-N-(2-aminosulfanyl-4-pyridinyl)-2-(cyclohexen-1-yl)-5,5-difluorocyclohexane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-(2-aminosulfanyl-4-pyridinyl)-2-(cyclohexen-1-yl)-5,5-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 178021397 |
| Molecular Formula | C18H23F2N3OS |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | trans-(1R,2R)-N-(2-aminosulfanyl-4-pyridinyl)-2-(cyclohexen-1-yl)-5,5-difluorocyclohexane-1-carboxamide |
| SMILES | NSc1cc(NC(=O)[C@@H]2CC(F)(F)CC[C@H]2C2=CCCCC2)ccn1 |
| InChI | InChI=1S/C18H23F2N3OS/c19-18(20)8-6-14(12-4-2-1-3-5-12)15(11-18)17(24)23-13-7-9-22-16(10-13)25-21/h4,7,9-10,14-15H,1-3,5-6,8,11,21H2,(H,22,23,24)/t14-,15+/m0/s1 |
| InChIKey | YRCXBYFANDJSQC-LSDHHAIUSA-N |
| XLogP | 4.54 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|