C18H25F2N3O — CID 178021638
2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide (PubChem CID 178021638) has the molecular formula C18H25F2N3O and a molecular weight of 337.41 g/mol. Its IUPAC name is 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide.
| Compound Name | 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 178021638 |
| Molecular Formula | C18H25F2N3O |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccnnc1)C1CC(F)(F)CCC1C1CCCCCC1 |
| InChI | InChI=1S/C18H25F2N3O/c19-18(20)9-7-15(13-5-3-1-2-4-6-13)16(11-18)17(24)23-14-8-10-21-22-12-14/h8,10,12-13,15-16H,1-7,9,11H2,(H,21,23,24) |
| InChIKey | OIVQEHSSWMDAEQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |