About 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide
2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide (PubChem CID 178021638) has the molecular formula C18H25F2N3O
and a molecular weight of 337.41 g/mol. Its IUPAC name is 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide |
| PubChem CID | 178021638 |
| Molecular Formula | C18H25F2N3O |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccnnc1)C1CC(F)(F)CCC1C1CCCCCC1 |
| InChI | InChI=1S/C18H25F2N3O/c19-18(20)9-7-15(13-5-3-1-2-4-6-13)16(11-18)17(24)23-14-8-10-21-22-12-14/h8,10,12-13,15-16H,1-7,9,11H2,(H,21,23,24) |
| InChIKey | OIVQEHSSWMDAEQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide?
The IUPAC name of 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide (CID 178021638) is 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide.
What is the SMILES notation for 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide?
The canonical SMILES for 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide is O=C(Nc1ccnnc1)C1CC(F)(F)CCC1C1CCCCCC1.
What is the InChIKey of 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide?
The InChIKey is OIVQEHSSWMDAEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25F2N3O/c19-18(20)9-7-15(13-5-3-1-2-4-6-13)16(11-18)17(24)23-14-8-10-21-22-12-14/h8,10,12-13,15-16H,1-7,9,11H2,(H,21,23,24).
What are the key properties of 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide?
2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide has a molecular weight of 337.41 g/mol, XLogP of 4.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyl-5,5-difluoro-N-pyridazin-4-ylcyclohexane-1-carboxamide is sourced from PubChem (CID 178021638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).