C14H22AlF2NO — CID 178021525
CID 178021525 (PubChem CID 178021525) has the molecular formula C14H22AlF2NO and a molecular weight of 285.31 g/mol.
| Compound Name | CID 178021525 |
|---|---|
| PubChem CID | 178021525 |
| Molecular Formula | C14H22AlF2NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | — |
| SMILES | O=C(N[Al])C1CC(F)(F)CCC1C1CCCCCC1 |
| InChI | InChI=1S/C14H23F2NO.Al/c15-14(16)8-7-11(12(9-14)13(17)18)10-5-3-1-2-4-6-10;/h10-12H,1-9H2,(H2,17,18);/q;+1/p-1 |
| InChIKey | YXTDKYTYVRFDTF-UHFFFAOYSA-M |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |