C17H23F2N3O2S — CID 178021502
cis-(1R,2S)-N-(2-aminosulfanyl-4-pyridinyl)-5,5-difluoro-2-(oxan-4-yl)cyclohexane-1-carboxamide (PubChem CID 178021502) has the molecular formula C17H23F2N3O2S and a molecular weight of 371.45 g/mol. Its IUPAC name is cis-(1R,2S)-N-(2-aminosulfanyl-4-pyridinyl)-5,5-difluoro-2-(oxan-4-yl)cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-(2-aminosulfanyl-4-pyridinyl)-5,5-difluoro-2-(oxan-4-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 178021502 |
| Molecular Formula | C17H23F2N3O2S |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | cis-(1R,2S)-N-(2-aminosulfanyl-4-pyridinyl)-5,5-difluoro-2-(oxan-4-yl)cyclohexane-1-carboxamide |
| SMILES | NSc1cc(NC(=O)[C@@H]2CC(F)(F)CC[C@H]2C2CCOCC2)ccn1 |
| InChI | InChI=1S/C17H23F2N3O2S/c18-17(19)5-1-13(11-3-7-24-8-4-11)14(10-17)16(23)22-12-2-6-21-15(9-12)25-20/h2,6,9,11,13-14H,1,3-5,7-8,10,20H2,(H,21,22,23)/t13-,14+/m0/s1 |
| InChIKey | MHZARGOYXAWWKT-UONOGXRCSA-N |
| XLogP | 3.46 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|