C19H21F2N3O2S — CID 177192159
N-(2-aminosulfanyl-4-pyridinyl)-2-(3,4-difluoro-2-methoxyphenyl)cyclohexane-1-carboxamide (PubChem CID 177192159) has the molecular formula C19H21F2N3O2S and a molecular weight of 393.46 g/mol. Its IUPAC name is N-(2-aminosulfanyl-4-pyridinyl)-2-(3,4-difluoro-2-methoxyphenyl)cyclohexane-1-carboxamide.
| Compound Name | N-(2-aminosulfanyl-4-pyridinyl)-2-(3,4-difluoro-2-methoxyphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 177192159 |
| Molecular Formula | C19H21F2N3O2S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-(2-aminosulfanyl-4-pyridinyl)-2-(3,4-difluoro-2-methoxyphenyl)cyclohexane-1-carboxamide |
| SMILES | COc1c(C2CCCCC2C(=O)Nc2ccnc(SN)c2)ccc(F)c1F |
| InChI | InChI=1S/C19H21F2N3O2S/c1-26-18-13(6-7-15(20)17(18)21)12-4-2-3-5-14(12)19(25)24-11-8-9-23-16(10-11)27-22/h6-10,12,14H,2-5,22H2,1H3,(H,23,24,25) |
| InChIKey | GLZKKEZYYGDFMP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|