C22H22F2N6O2S — CID 177192512
N-(2-aminosulfanyl-4-pyridinyl)-1-(3,4-difluoro-2-methoxyphenyl)-4-pyridin-2-ylpiperazine-2-carboxamide (PubChem CID 177192512) has the molecular formula C22H22F2N6O2S and a molecular weight of 472.52 g/mol. Its IUPAC name is N-(2-aminosulfanyl-4-pyridinyl)-1-(3,4-difluoro-2-methoxyphenyl)-4-pyridin-2-ylpiperazine-2-carboxamide.
| Compound Name | N-(2-aminosulfanyl-4-pyridinyl)-1-(3,4-difluoro-2-methoxyphenyl)-4-pyridin-2-ylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 177192512 |
| Molecular Formula | C22H22F2N6O2S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-(2-aminosulfanyl-4-pyridinyl)-1-(3,4-difluoro-2-methoxyphenyl)-4-pyridin-2-ylpiperazine-2-carboxamide |
| SMILES | COc1c(N2CCN(c3ccccn3)CC2C(=O)Nc2ccnc(SN)c2)ccc(F)c1F |
| InChI | InChI=1S/C22H22F2N6O2S/c1-32-21-16(6-5-15(23)20(21)24)30-11-10-29(18-4-2-3-8-26-18)13-17(30)22(31)28-14-7-9-27-19(12-14)33-25/h2-9,12,17H,10-11,13,25H2,1H3,(H,27,28,31) |
| InChIKey | MRDUTLKJYLMXAW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|