C19H16F7N3O2S — CID 177192896
N-(3-aminosulfanylphenyl)-1-[3,4-difluoro-2-(trifluoromethoxy)phenyl]-4,4-difluoropiperidine-2-carboxamide (PubChem CID 177192896) has the molecular formula C19H16F7N3O2S and a molecular weight of 483.41 g/mol. Its IUPAC name is N-(3-aminosulfanylphenyl)-1-[3,4-difluoro-2-(trifluoromethoxy)phenyl]-4,4-difluoropiperidine-2-carboxamide.
| Compound Name | N-(3-aminosulfanylphenyl)-1-[3,4-difluoro-2-(trifluoromethoxy)phenyl]-4,4-difluoropiperidine-2-carboxamide |
|---|---|
| PubChem CID | 177192896 |
| Molecular Formula | C19H16F7N3O2S |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | N-(3-aminosulfanylphenyl)-1-[3,4-difluoro-2-(trifluoromethoxy)phenyl]-4,4-difluoropiperidine-2-carboxamide |
| SMILES | NSc1cccc(NC(=O)C2CC(F)(F)CCN2c2ccc(F)c(F)c2OC(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F7N3O2S/c20-12-4-5-13(16(15(12)21)31-19(24,25)26)29-7-6-18(22,23)9-14(29)17(30)28-10-2-1-3-11(8-10)32-27/h1-5,8,14H,6-7,9,27H2,(H,28,30) |
| InChIKey | PQKUDDLSGQMDKV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|