C13H9Cl2FN2OS — CID 144778756
N-(3-aminosulfanylphenyl)-4,5-dichloro-2-fluorobenzamide (PubChem CID 144778756) has the molecular formula C13H9Cl2FN2OS and a molecular weight of 331.20 g/mol. Its IUPAC name is N-(3-aminosulfanylphenyl)-4,5-dichloro-2-fluorobenzamide.
| Compound Name | N-(3-aminosulfanylphenyl)-4,5-dichloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 144778756 |
| Molecular Formula | C13H9Cl2FN2OS |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | N-(3-aminosulfanylphenyl)-4,5-dichloro-2-fluorobenzamide |
| SMILES | NSc1cccc(NC(=O)c2cc(Cl)c(Cl)cc2F)c1 |
| InChI | InChI=1S/C13H9Cl2FN2OS/c14-10-5-9(12(16)6-11(10)15)13(19)18-7-2-1-3-8(4-7)20-17/h1-6H,17H2,(H,18,19) |
| InChIKey | JRPHLGQJYWFURW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|