C21H26F2N2O2S — CID 177192646
N-(3-aminosulfanylphenyl)cycloheptanecarboxamide;1,2-difluoro-3-methoxybenzene (PubChem CID 177192646) has the molecular formula C21H26F2N2O2S and a molecular weight of 408.51 g/mol. Its IUPAC name is N-(3-aminosulfanylphenyl)cycloheptanecarboxamide;1,2-difluoro-3-methoxybenzene.
| Compound Name | N-(3-aminosulfanylphenyl)cycloheptanecarboxamide;1,2-difluoro-3-methoxybenzene |
|---|---|
| PubChem CID | 177192646 |
| Molecular Formula | C21H26F2N2O2S |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-(3-aminosulfanylphenyl)cycloheptanecarboxamide;1,2-difluoro-3-methoxybenzene |
| SMILES | COc1cccc(F)c1F.NSc1cccc(NC(=O)C2CCCCCC2)c1 |
| InChI | InChI=1S/C14H20N2OS.C7H6F2O/c15-18-13-9-5-8-12(10-13)16-14(17)11-6-3-1-2-4-7-11;1-10-6-4-2-3-5(8)7(6)9/h5,8-11H,1-4,6-7,15H2,(H,16,17);2-4H,1H3 |
| InChIKey | XNCDAIIGPZCRJN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|