C24H24F4N4O2S — CID 177192830
(3S)-N-(2-aminosulfanyl-4-pyridinyl)-1-(2,4-difluorophenyl)piperidine-3-carboxamide;1,2-difluoro-3-methoxybenzene (PubChem CID 177192830) has the molecular formula C24H24F4N4O2S and a molecular weight of 508.54 g/mol. Its IUPAC name is (3S)-N-(2-aminosulfanyl-4-pyridinyl)-1-(2,4-difluorophenyl)piperidine-3-carboxamide;1,2-difluoro-3-methoxybenzene.
| Compound Name | (3S)-N-(2-aminosulfanyl-4-pyridinyl)-1-(2,4-difluorophenyl)piperidine-3-carboxamide;1,2-difluoro-3-methoxybenzene |
|---|---|
| PubChem CID | 177192830 |
| Molecular Formula | C24H24F4N4O2S |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | (3S)-N-(2-aminosulfanyl-4-pyridinyl)-1-(2,4-difluorophenyl)piperidine-3-carboxamide;1,2-difluoro-3-methoxybenzene |
| SMILES | COc1cccc(F)c1F.NSc1cc(NC(=O)[C@H]2CCCN(c3ccc(F)cc3F)C2)ccn1 |
| InChI | InChI=1S/C17H18F2N4OS.C7H6F2O/c18-12-3-4-15(14(19)8-12)23-7-1-2-11(10-23)17(24)22-13-5-6-21-16(9-13)25-20;1-10-6-4-2-3-5(8)7(6)9/h3-6,8-9,11H,1-2,7,10,20H2,(H,21,22,24);2-4H,1H3/t11-;/m0./s1 |
| InChIKey | ATOGFOILFZHPEC-MERQFXBCSA-N |
| XLogP | 5.15 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|