C18H15F7N4OS — CID 177192487
N-(2-aminosulfanyl-4-pyridinyl)-1-[3,4-difluoro-2-(trifluoromethyl)phenyl]-4,4-difluoropiperidine-2-carboxamide (PubChem CID 177192487) has the molecular formula C18H15F7N4OS and a molecular weight of 468.40 g/mol. Its IUPAC name is N-(2-aminosulfanyl-4-pyridinyl)-1-[3,4-difluoro-2-(trifluoromethyl)phenyl]-4,4-difluoropiperidine-2-carboxamide.
| Compound Name | N-(2-aminosulfanyl-4-pyridinyl)-1-[3,4-difluoro-2-(trifluoromethyl)phenyl]-4,4-difluoropiperidine-2-carboxamide |
|---|---|
| PubChem CID | 177192487 |
| Molecular Formula | C18H15F7N4OS |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | N-(2-aminosulfanyl-4-pyridinyl)-1-[3,4-difluoro-2-(trifluoromethyl)phenyl]-4,4-difluoropiperidine-2-carboxamide |
| SMILES | NSc1cc(NC(=O)C2CC(F)(F)CCN2c2ccc(F)c(F)c2C(F)(F)F)ccn1 |
| InChI | InChI=1S/C18H15F7N4OS/c19-10-1-2-11(14(15(10)20)18(23,24)25)29-6-4-17(21,22)8-12(29)16(30)28-9-3-5-27-13(7-9)31-26/h1-3,5,7,12H,4,6,8,26H2,(H,27,28,30) |
| InChIKey | RFHRKGKBYXLNMI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|