C20H24F2N4O2S — CID 178057582
N-(2-aminosulfanyl-4-pyridinyl)-1-(3,4-difluoro-2-methoxyphenyl)-2,4,4-trimethylpyrrolidine-2-carboxamide (PubChem CID 178057582) has the molecular formula C20H24F2N4O2S and a molecular weight of 422.50 g/mol. Its IUPAC name is N-(2-aminosulfanyl-4-pyridinyl)-1-(3,4-difluoro-2-methoxyphenyl)-2,4,4-trimethylpyrrolidine-2-carboxamide.
| Compound Name | N-(2-aminosulfanyl-4-pyridinyl)-1-(3,4-difluoro-2-methoxyphenyl)-2,4,4-trimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 178057582 |
| Molecular Formula | C20H24F2N4O2S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-(2-aminosulfanyl-4-pyridinyl)-1-(3,4-difluoro-2-methoxyphenyl)-2,4,4-trimethylpyrrolidine-2-carboxamide |
| SMILES | COc1c(N2CC(C)(C)CC2(C)C(=O)Nc2ccnc(SN)c2)ccc(F)c1F |
| InChI | InChI=1S/C20H24F2N4O2S/c1-19(2)10-20(3,18(27)25-12-7-8-24-15(9-12)29-23)26(11-19)14-6-5-13(21)16(22)17(14)28-4/h5-9H,10-11,23H2,1-4H3,(H,24,25,27) |
| InChIKey | ZBWQEOIYXKBPLV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|