C13H13ClF2INO — CID 114258882
N-(2-chloro-5-iodophenyl)-3,3-difluorocyclohexane-1-carboxamide (PubChem CID 114258882) has the molecular formula C13H13ClF2INO and a molecular weight of 399.61 g/mol. Its IUPAC name is N-(2-chloro-5-iodophenyl)-3,3-difluorocyclohexane-1-carboxamide.
| Compound Name | N-(2-chloro-5-iodophenyl)-3,3-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114258882 |
| Molecular Formula | C13H13ClF2INO |
| Molecular Weight | 399.61 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | N-(2-chloro-5-iodophenyl)-3,3-difluorocyclohexane-1-carboxamide |
| SMILES | O=C(Nc1cc(I)ccc1Cl)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C13H13ClF2INO/c14-10-4-3-9(17)6-11(10)18-12(19)8-2-1-5-13(15,16)7-8/h3-4,6,8H,1-2,5,7H2,(H,18,19) |
| InChIKey | LMGBJRMOZBADOZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|