C13H12ClIN2O — CID 113255375
N-(2-chloro-5-iodophenyl)-1-cyanocyclopentane-1-carboxamide (PubChem CID 113255375) has the molecular formula C13H12ClIN2O and a molecular weight of 374.61 g/mol. Its IUPAC name is N-(2-chloro-5-iodophenyl)-1-cyanocyclopentane-1-carboxamide.
| Compound Name | N-(2-chloro-5-iodophenyl)-1-cyanocyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 113255375 |
| Molecular Formula | C13H12ClIN2O |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | N-(2-chloro-5-iodophenyl)-1-cyanocyclopentane-1-carboxamide |
| SMILES | N#CC1(C(=O)Nc2cc(I)ccc2Cl)CCCC1 |
| InChI | InChI=1S/C13H12ClIN2O/c14-10-4-3-9(15)7-11(10)17-12(18)13(8-16)5-1-2-6-13/h3-4,7H,1-2,5-6H2,(H,17,18) |
| InChIKey | GXFOWJUYXXFEAV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|