C11H7BrCl2N2O — CID 114001899
N-(4-bromo-2,3-dichlorophenyl)-1-cyanocyclopropane-1-carboxamide (PubChem CID 114001899) has the molecular formula C11H7BrCl2N2O and a molecular weight of 334.00 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-1-cyanocyclopropane-1-carboxamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-1-cyanocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 114001899 |
| Molecular Formula | C11H7BrCl2N2O |
| Molecular Weight | 334.00 g/mol |
| Exact Mass | 331.91 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-1-cyanocyclopropane-1-carboxamide |
| SMILES | N#CC1(C(=O)Nc2ccc(Br)c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C11H7BrCl2N2O/c12-6-1-2-7(9(14)8(6)13)16-10(17)11(5-15)3-4-11/h1-2H,3-4H2,(H,16,17) |
| InChIKey | ANNUQKYGRSFKPL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.00 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|