C12H11IN2O — CID 78995000
1-cyano-N-(4-iodophenyl)cyclobutane-1-carboxamide (PubChem CID 78995000) has the molecular formula C12H11IN2O and a molecular weight of 326.14 g/mol. Its IUPAC name is 1-cyano-N-(4-iodophenyl)cyclobutane-1-carboxamide.
| Compound Name | 1-cyano-N-(4-iodophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 78995000 |
| Molecular Formula | C12H11IN2O |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 1-cyano-N-(4-iodophenyl)cyclobutane-1-carboxamide |
| SMILES | N#CC1(C(=O)Nc2ccc(I)cc2)CCC1 |
| InChI | InChI=1S/C12H11IN2O/c13-9-2-4-10(5-3-9)15-11(16)12(8-14)6-1-7-12/h2-5H,1,6-7H2,(H,15,16) |
| InChIKey | HHGYZRLSJVJBBW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|