C15H16F2N2OS — CID 61459503
1-cyano-N-[4-(difluoromethylsulfanyl)phenyl]cyclohexane-1-carboxamide (PubChem CID 61459503) has the molecular formula C15H16F2N2OS and a molecular weight of 310.37 g/mol. Its IUPAC name is 1-cyano-N-[4-(difluoromethylsulfanyl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 1-cyano-N-[4-(difluoromethylsulfanyl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 61459503 |
| Molecular Formula | C15H16F2N2OS |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-cyano-N-[4-(difluoromethylsulfanyl)phenyl]cyclohexane-1-carboxamide |
| SMILES | N#CC1(C(=O)Nc2ccc(SC(F)F)cc2)CCCCC1 |
| InChI | InChI=1S/C15H16F2N2OS/c16-14(17)21-12-6-4-11(5-7-12)19-13(20)15(10-18)8-2-1-3-9-15/h4-7,14H,1-3,8-9H2,(H,19,20) |
| InChIKey | OHHYKZNRCHSFMD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |